C29H24N4O7 — CID 134537854
4-[2-carboxy-2-[[6-[4-(diaminomethylideneamino)benzoyl]oxynaphthalene-1-carbonyl]amino]ethyl]benzoic acid (PubChem CID 134537854) has the molecular formula C29H24N4O7 and a molecular weight of 540.53 g/mol. Its IUPAC name is 4-[2-carboxy-2-[[6-[4-(diaminomethylideneamino)benzoyl]oxynaphthalene-1-carbonyl]amino]ethyl]benzoic acid.
| Compound Name | 4-[2-carboxy-2-[[6-[4-(diaminomethylideneamino)benzoyl]oxynaphthalene-1-carbonyl]amino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 134537854 |
| Molecular Formula | C29H24N4O7 |
| Molecular Weight | 540.53 g/mol |
| Exact Mass | 540.16 |
| IUPAC Name | 4-[2-carboxy-2-[[6-[4-(diaminomethylideneamino)benzoyl]oxynaphthalene-1-carbonyl]amino]ethyl]benzoic acid |
| SMILES | NC(N)=Nc1ccc(C(=O)Oc2ccc3c(C(=O)NC(Cc4ccc(C(=O)O)cc4)C(=O)O)cccc3c2)cc1 |
| InChI | InChI=1S/C29H24N4O7/c30-29(31)32-20-10-8-18(9-11-20)28(39)40-21-12-13-22-19(15-21)2-1-3-23(22)25(34)33-24(27(37)38)14-16-4-6-17(7-5-16)26(35)36/h1-13,15,24H,14H2,(H,33,34)(H,35,36)(H,37,38)(H4,30,31,32) |
| InChIKey | PHQUSIJEABTICC-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 194.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.53 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|