C26H23ClN4O7 — CID 71516565
4-[(2S)-2-carboxy-2-[[2-[2-chloro-4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]acetyl]amino]ethyl]benzoic acid (PubChem CID 71516565) has the molecular formula C26H23ClN4O7 and a molecular weight of 538.94 g/mol. Its IUPAC name is 4-[(2S)-2-carboxy-2-[[2-[2-chloro-4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]acetyl]amino]ethyl]benzoic acid.
| Compound Name | 4-[(2S)-2-carboxy-2-[[2-[2-chloro-4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]acetyl]amino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 71516565 |
| Molecular Formula | C26H23ClN4O7 |
| Molecular Weight | 538.94 g/mol |
| Exact Mass | 538.13 |
| IUPAC Name | 4-[(2S)-2-carboxy-2-[[2-[2-chloro-4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]acetyl]amino]ethyl]benzoic acid |
| SMILES | NC(N)=Nc1ccc(C(=O)Oc2ccc(CC(=O)N[C@@H](Cc3ccc(C(=O)O)cc3)C(=O)O)c(Cl)c2)cc1 |
| InChI | InChI=1S/C26H23ClN4O7/c27-20-13-19(38-25(37)16-5-8-18(9-6-16)30-26(28)29)10-7-17(20)12-22(32)31-21(24(35)36)11-14-1-3-15(4-2-14)23(33)34/h1-10,13,21H,11-12H2,(H,31,32)(H,33,34)(H,35,36)(H4,28,29,30)/t21-/m0/s1 |
| InChIKey | WSQXGFKMOUOXGW-NRFANRHFSA-N |
| XLogP | 2.52 |
| TPSA | 194.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.94 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|