C25H23ClN4O5 — CID 89451929
2-[3-[3-[2-chloro-4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]propanoylamino]phenyl]acetic acid (PubChem CID 89451929) has the molecular formula C25H23ClN4O5 and a molecular weight of 494.94 g/mol. Its IUPAC name is 2-[3-[3-[2-chloro-4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]propanoylamino]phenyl]acetic acid.
| Compound Name | 2-[3-[3-[2-chloro-4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]propanoylamino]phenyl]acetic acid |
|---|---|
| PubChem CID | 89451929 |
| Molecular Formula | C25H23ClN4O5 |
| Molecular Weight | 494.94 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | 2-[3-[3-[2-chloro-4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]propanoylamino]phenyl]acetic acid |
| SMILES | NC(N)=Nc1ccc(C(=O)Oc2ccc(CCC(=O)Nc3cccc(CC(=O)O)c3)c(Cl)c2)cc1 |
| InChI | InChI=1S/C25H23ClN4O5/c26-21-14-20(35-24(34)17-4-8-18(9-5-17)30-25(27)28)10-6-16(21)7-11-22(31)29-19-3-1-2-15(12-19)13-23(32)33/h1-6,8-10,12,14H,7,11,13H2,(H,29,31)(H,32,33)(H4,27,28,30) |
| InChIKey | ZOUGVYIXJNSKKV-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 157.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.94 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|