C28H29N5O12 — CID 118292786
(2S)-2-[3-[2-[5,5-bis(carboxymethyl)-4H-1,2-oxazol-3-yl]-4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]propanoylamino]butanedioic acid (PubChem CID 118292786) has the molecular formula C28H29N5O12 and a molecular weight of 627.56 g/mol. Its IUPAC name is (2S)-2-[3-[2-[5,5-bis(carboxymethyl)-4H-1,2-oxazol-3-yl]-4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]propanoylamino]butanedioic acid.
| Compound Name | (2S)-2-[3-[2-[5,5-bis(carboxymethyl)-4H-1,2-oxazol-3-yl]-4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]propanoylamino]butanedioic acid |
|---|---|
| PubChem CID | 118292786 |
| Molecular Formula | C28H29N5O12 |
| Molecular Weight | 627.56 g/mol |
| Exact Mass | 627.18 |
| IUPAC Name | (2S)-2-[3-[2-[5,5-bis(carboxymethyl)-4H-1,2-oxazol-3-yl]-4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]propanoylamino]butanedioic acid |
| SMILES | NC(N)=Nc1ccc(C(=O)Oc2ccc(CCC(=O)N[C@@H](CC(=O)O)C(=O)O)c(C3=NOC(CC(=O)O)(CC(=O)O)C3)c2)cc1 |
| InChI | InChI=1S/C28H29N5O12/c29-27(30)31-16-5-1-15(2-6-16)26(43)44-17-7-3-14(4-8-21(34)32-19(25(41)42)10-22(35)36)18(9-17)20-11-28(45-33-20,12-23(37)38)13-24(39)40/h1-3,5-7,9,19H,4,8,10-13H2,(H,32,34)(H,35,36)(H,37,38)(H,39,40)(H,41,42)(H4,29,30,31)/t19-/m0/s1 |
| InChIKey | ZRCLUWZNKCYGCK-IBGZPJMESA-N |
| XLogP | 0.60 |
| TPSA | 290.59 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.56 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|