C20H18N4O7 — CID 118292863
5-(carboxymethyl)-3-[4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]-4H-1,2-oxazole-5-carboxylic acid (PubChem CID 118292863) has the molecular formula C20H18N4O7 and a molecular weight of 426.39 g/mol. Its IUPAC name is 5-(carboxymethyl)-3-[4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]-4H-1,2-oxazole-5-carboxylic acid.
| Compound Name | 5-(carboxymethyl)-3-[4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]-4H-1,2-oxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 118292863 |
| Molecular Formula | C20H18N4O7 |
| Molecular Weight | 426.39 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | 5-(carboxymethyl)-3-[4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]-4H-1,2-oxazole-5-carboxylic acid |
| SMILES | NC(N)=Nc1ccc(C(=O)Oc2ccc(C3=NOC(CC(=O)O)(C(=O)O)C3)cc2)cc1 |
| InChI | InChI=1S/C20H18N4O7/c21-19(22)23-13-5-1-12(2-6-13)17(27)30-14-7-3-11(4-8-14)15-9-20(18(28)29,31-24-15)10-16(25)26/h1-8H,9-10H2,(H,25,26)(H,28,29)(H4,21,22,23) |
| InChIKey | PHFIZYLYAFHJQQ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 186.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.39 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|