C27H31N3O7 — CID 144902267
2-(carboxymethyl)-4-[2-cyclohexyl-5-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]oxolane-2-carboxylic acid (PubChem CID 144902267) has the molecular formula C27H31N3O7 and a molecular weight of 509.56 g/mol. Its IUPAC name is 2-(carboxymethyl)-4-[2-cyclohexyl-5-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]oxolane-2-carboxylic acid.
| Compound Name | 2-(carboxymethyl)-4-[2-cyclohexyl-5-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]oxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 144902267 |
| Molecular Formula | C27H31N3O7 |
| Molecular Weight | 509.56 g/mol |
| Exact Mass | 509.22 |
| IUPAC Name | 2-(carboxymethyl)-4-[2-cyclohexyl-5-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]oxolane-2-carboxylic acid |
| SMILES | NC(N)=Nc1ccc(C(=O)Oc2ccc(C3CCCCC3)c(C3COC(CC(=O)O)(C(=O)O)C3)c2)cc1 |
| InChI | InChI=1S/C27H31N3O7/c28-26(29)30-19-8-6-17(7-9-19)24(33)37-20-10-11-21(16-4-2-1-3-5-16)22(12-20)18-13-27(25(34)35,36-15-18)14-23(31)32/h6-12,16,18H,1-5,13-15H2,(H,31,32)(H,34,35)(H4,28,29,30) |
| InChIKey | ODRBOPSDDOXQTA-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 174.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.56 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|