C23H26N4O5 — CID 90291151
3-[[2-[4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]acetyl]amino]cyclohexane-1-carboxylic acid (PubChem CID 90291151) has the molecular formula C23H26N4O5 and a molecular weight of 438.48 g/mol. Its IUPAC name is 3-[[2-[4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]acetyl]amino]cyclohexane-1-carboxylic acid.
| Compound Name | 3-[[2-[4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]acetyl]amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 90291151 |
| Molecular Formula | C23H26N4O5 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | 3-[[2-[4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]acetyl]amino]cyclohexane-1-carboxylic acid |
| SMILES | NC(N)=Nc1ccc(C(=O)Oc2ccc(CC(=O)NC3CCCC(C(=O)O)C3)cc2)cc1 |
| InChI | InChI=1S/C23H26N4O5/c24-23(25)27-17-8-6-15(7-9-17)22(31)32-19-10-4-14(5-11-19)12-20(28)26-18-3-1-2-16(13-18)21(29)30/h4-11,16,18H,1-3,12-13H2,(H,26,28)(H,29,30)(H4,24,25,27) |
| InChIKey | NZNVWWKZPYRRSG-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 157.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|