C16H14N3O4- — CID 53444070
2-[4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]acetate (PubChem CID 53444070) has the molecular formula C16H14N3O4- and a molecular weight of 312.31 g/mol. Its IUPAC name is 2-[4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]acetate.
| Compound Name | 2-[4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]acetate |
|---|---|
| PubChem CID | 53444070 |
| Molecular Formula | C16H14N3O4- |
| Molecular Weight | 312.31 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 2-[4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]acetate |
| SMILES | NC(N)=Nc1ccc(C(=O)Oc2ccc(CC(=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C16H15N3O4/c17-16(18)19-12-5-3-11(4-6-12)15(22)23-13-7-1-10(2-8-13)9-14(20)21/h1-8H,9H2,(H,20,21)(H4,17,18,19)/p-1 |
| InChIKey | XTKGXPFBKPYFDW-UHFFFAOYSA-M |
| XLogP | 0.10 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.31 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|