C21H20N4O7 — CID 118292789
5-(carboxymethyl)-3-[3-[4-(diaminomethylideneamino)benzoyl]oxy-2-methylphenyl]-4H-1,2-oxazole-5-carboxylic acid (PubChem CID 118292789) has the molecular formula C21H20N4O7 and a molecular weight of 440.41 g/mol. Its IUPAC name is 5-(carboxymethyl)-3-[3-[4-(diaminomethylideneamino)benzoyl]oxy-2-methylphenyl]-4H-1,2-oxazole-5-carboxylic acid.
| Compound Name | 5-(carboxymethyl)-3-[3-[4-(diaminomethylideneamino)benzoyl]oxy-2-methylphenyl]-4H-1,2-oxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 118292789 |
| Molecular Formula | C21H20N4O7 |
| Molecular Weight | 440.41 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | 5-(carboxymethyl)-3-[3-[4-(diaminomethylideneamino)benzoyl]oxy-2-methylphenyl]-4H-1,2-oxazole-5-carboxylic acid |
| SMILES | Cc1c(OC(=O)c2ccc(N=C(N)N)cc2)cccc1C1=NOC(CC(=O)O)(C(=O)O)C1 |
| InChI | InChI=1S/C21H20N4O7/c1-11-14(15-9-21(19(29)30,32-25-15)10-17(26)27)3-2-4-16(11)31-18(28)12-5-7-13(8-6-12)24-20(22)23/h2-8H,9-10H2,1H3,(H,26,27)(H,29,30)(H4,22,23,24) |
| InChIKey | BLTGFDKODIEVBB-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 186.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.41 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|