C36H47N5O10S — CID 118292752
[3-[5,5-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-4H-1,2-oxazol-3-yl]-4-[3-(1,1-dioxo-1,4-thiazinan-4-yl)-3-oxopropyl]phenyl] 4-(diaminomethylideneamino)benzoate (PubChem CID 118292752) has the molecular formula C36H47N5O10S and a molecular weight of 741.86 g/mol. Its IUPAC name is [3-[5,5-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-4H-1,2-oxazol-3-yl]-4-[3-(1,1-dioxo-1,4-thiazinan-4-yl)-3-oxopropyl]phenyl] 4-(diaminomethylideneamino)benzoate.
| Compound Name | [3-[5,5-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-4H-1,2-oxazol-3-yl]-4-[3-(1,1-dioxo-1,4-thiazinan-4-yl)-3-oxopropyl]phenyl] 4-(diaminomethylideneamino)benzoate |
|---|---|
| PubChem CID | 118292752 |
| Molecular Formula | C36H47N5O10S |
| Molecular Weight | 741.86 g/mol |
| Exact Mass | 741.30 |
| IUPAC Name | [3-[5,5-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-4H-1,2-oxazol-3-yl]-4-[3-(1,1-dioxo-1,4-thiazinan-4-yl)-3-oxopropyl]phenyl] 4-(diaminomethylideneamino)benzoate |
| SMILES | CC(C)(C)OC(=O)CC1(CC(=O)OC(C)(C)C)CC(c2cc(OC(=O)c3ccc(N=C(N)N)cc3)ccc2CCC(=O)N2CCS(=O)(=O)CC2)=NO1 |
| InChI | InChI=1S/C36H47N5O10S/c1-34(2,3)49-30(43)21-36(22-31(44)50-35(4,5)6)20-28(40-51-36)27-19-26(48-32(45)24-7-11-25(12-8-24)39-33(37)38)13-9-23(27)10-14-29(42)41-15-17-52(46,47)18-16-41/h7-9,11-13,19H,10,14-18,20-22H2,1-6H3,(H4,37,38,39) |
| InChIKey | BKBIPJHZXBRJLT-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 219.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.86 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|