C26H27N5O13 — CID 142579022
(2S)-2-[[2-[[4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]methoxycarbonyl-[(1S)-1,2-dicarboxyethyl]amino]acetyl]amino]butanedioic acid (PubChem CID 142579022) has the molecular formula C26H27N5O13 and a molecular weight of 617.52 g/mol. Its IUPAC name is (2S)-2-[[2-[[4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]methoxycarbonyl-[(1S)-1,2-dicarboxyethyl]amino]acetyl]amino]butanedioic acid.
| Compound Name | (2S)-2-[[2-[[4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]methoxycarbonyl-[(1S)-1,2-dicarboxyethyl]amino]acetyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 142579022 |
| Molecular Formula | C26H27N5O13 |
| Molecular Weight | 617.52 g/mol |
| Exact Mass | 617.16 |
| IUPAC Name | (2S)-2-[[2-[[4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]methoxycarbonyl-[(1S)-1,2-dicarboxyethyl]amino]acetyl]amino]butanedioic acid |
| SMILES | NC(N)=Nc1ccc(C(=O)Oc2ccc(COC(=O)N(CC(=O)N[C@@H](CC(=O)O)C(=O)O)[C@@H](CC(=O)O)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C26H27N5O13/c27-25(28)29-15-5-3-14(4-6-15)24(41)44-16-7-1-13(2-8-16)12-43-26(42)31(18(23(39)40)10-21(35)36)11-19(32)30-17(22(37)38)9-20(33)34/h1-8,17-18H,9-12H2,(H,30,32)(H,33,34)(H,35,36)(H,37,38)(H,39,40)(H4,27,28,29)/t17-,18-/m0/s1 |
| InChIKey | PLBAICFAECDRDC-ROUUACIJSA-N |
| XLogP | -0.28 |
| TPSA | 298.54 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.52 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|