C31H32N4O9 — CID 155259544
(2S)-2-[[4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]methoxycarbonyl-[[3-(2-methylpropanoyl)phenyl]methyl]amino]butanedioic acid (PubChem CID 155259544) has the molecular formula C31H32N4O9 and a molecular weight of 604.62 g/mol. Its IUPAC name is (2S)-2-[[4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]methoxycarbonyl-[[3-(2-methylpropanoyl)phenyl]methyl]amino]butanedioic acid.
| Compound Name | (2S)-2-[[4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]methoxycarbonyl-[[3-(2-methylpropanoyl)phenyl]methyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 155259544 |
| Molecular Formula | C31H32N4O9 |
| Molecular Weight | 604.62 g/mol |
| Exact Mass | 604.22 |
| IUPAC Name | (2S)-2-[[4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]methoxycarbonyl-[[3-(2-methylpropanoyl)phenyl]methyl]amino]butanedioic acid |
| SMILES | CC(C)C(=O)c1cccc(CN(C(=O)OCc2ccc(OC(=O)c3ccc(N=C(N)N)cc3)cc2)[C@@H](CC(=O)O)C(=O)O)c1 |
| InChI | InChI=1S/C31H32N4O9/c1-18(2)27(38)22-5-3-4-20(14-22)16-35(25(28(39)40)15-26(36)37)31(42)43-17-19-6-12-24(13-7-19)44-29(41)21-8-10-23(11-9-21)34-30(32)33/h3-14,18,25H,15-17H2,1-2H3,(H,36,37)(H,39,40)(H4,32,33,34)/t25-/m0/s1 |
| InChIKey | ATUVQXRYSUPXET-VWLOTQADSA-N |
| XLogP | 3.72 |
| TPSA | 211.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.62 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|