C24H22ClN3O3 — CID 159968217
[3-chloro-4-[3-(3-methylphenyl)-2-oxopropyl]phenyl] 4-(diaminomethylideneamino)benzoate (PubChem CID 159968217) has the molecular formula C24H22ClN3O3 and a molecular weight of 435.91 g/mol. Its IUPAC name is [3-chloro-4-[3-(3-methylphenyl)-2-oxopropyl]phenyl] 4-(diaminomethylideneamino)benzoate.
| Compound Name | [3-chloro-4-[3-(3-methylphenyl)-2-oxopropyl]phenyl] 4-(diaminomethylideneamino)benzoate |
|---|---|
| PubChem CID | 159968217 |
| Molecular Formula | C24H22ClN3O3 |
| Molecular Weight | 435.91 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | [3-chloro-4-[3-(3-methylphenyl)-2-oxopropyl]phenyl] 4-(diaminomethylideneamino)benzoate |
| SMILES | Cc1cccc(CC(=O)Cc2ccc(OC(=O)c3ccc(N=C(N)N)cc3)cc2Cl)c1 |
| InChI | InChI=1S/C24H22ClN3O3/c1-15-3-2-4-16(11-15)12-20(29)13-18-7-10-21(14-22(18)25)31-23(30)17-5-8-19(9-6-17)28-24(26)27/h2-11,14H,12-13H2,1H3,(H4,26,27,28) |
| InChIKey | FYKYHHVLSOQWGC-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.91 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|