C27H27ClN6O7 — CID 90291203
2-[[2-[4-[4-[[amino(hydrazinyl)methylidene]amino]benzoyl]oxy-2-chlorophenyl]acetyl]-[2-(3-aminooxycarbonylphenyl)ethyl]amino]acetic acid (PubChem CID 90291203) has the molecular formula C27H27ClN6O7 and a molecular weight of 583.00 g/mol. Its IUPAC name is 2-[[2-[4-[4-[[amino(hydrazinyl)methylidene]amino]benzoyl]oxy-2-chlorophenyl]acetyl]-[2-(3-aminooxycarbonylphenyl)ethyl]amino]acetic acid.
| Compound Name | 2-[[2-[4-[4-[[amino(hydrazinyl)methylidene]amino]benzoyl]oxy-2-chlorophenyl]acetyl]-[2-(3-aminooxycarbonylphenyl)ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 90291203 |
| Molecular Formula | C27H27ClN6O7 |
| Molecular Weight | 583.00 g/mol |
| Exact Mass | 582.16 |
| IUPAC Name | 2-[[2-[4-[4-[[amino(hydrazinyl)methylidene]amino]benzoyl]oxy-2-chlorophenyl]acetyl]-[2-(3-aminooxycarbonylphenyl)ethyl]amino]acetic acid |
| SMILES | NN/C(N)=N/c1ccc(C(=O)Oc2ccc(CC(=O)N(CCc3cccc(C(=O)ON)c3)CC(=O)O)c(Cl)c2)cc1 |
| InChI | InChI=1S/C27H27ClN6O7/c28-22-14-21(40-25(38)17-4-7-20(8-5-17)32-27(29)33-30)9-6-18(22)13-23(35)34(15-24(36)37)11-10-16-2-1-3-19(12-16)26(39)41-31/h1-9,12,14H,10-11,13,15,30-31H2,(H,36,37)(H3,29,32,33) |
| InChIKey | RUVMBYKXDWJTQI-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 212.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.00 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|