C28H26N4O8 — CID 134537853
3-[[carboxymethyl-[2-[5-[4-(diaminomethylideneamino)benzoyl]oxy-1,3-dihydro-2-benzofuran-1-yl]acetyl]amino]methyl]benzoic acid (PubChem CID 134537853) has the molecular formula C28H26N4O8 and a molecular weight of 546.54 g/mol. Its IUPAC name is 3-[[carboxymethyl-[2-[5-[4-(diaminomethylideneamino)benzoyl]oxy-1,3-dihydro-2-benzofuran-1-yl]acetyl]amino]methyl]benzoic acid.
| Compound Name | 3-[[carboxymethyl-[2-[5-[4-(diaminomethylideneamino)benzoyl]oxy-1,3-dihydro-2-benzofuran-1-yl]acetyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 134537853 |
| Molecular Formula | C28H26N4O8 |
| Molecular Weight | 546.54 g/mol |
| Exact Mass | 546.18 |
| IUPAC Name | 3-[[carboxymethyl-[2-[5-[4-(diaminomethylideneamino)benzoyl]oxy-1,3-dihydro-2-benzofuran-1-yl]acetyl]amino]methyl]benzoic acid |
| SMILES | NC(N)=Nc1ccc(C(=O)Oc2ccc3c(c2)COC3CC(=O)N(CC(=O)O)Cc2cccc(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C28H26N4O8/c29-28(30)31-20-6-4-17(5-7-20)27(38)40-21-8-9-22-19(11-21)15-39-23(22)12-24(33)32(14-25(34)35)13-16-2-1-3-18(10-16)26(36)37/h1-11,23H,12-15H2,(H,34,35)(H,36,37)(H4,29,30,31) |
| InChIKey | NSECWWJDXVOQRR-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 194.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.54 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|