C29H25F3N4O4 — CID 168751782
(2S)-3-[4-(diaminomethylideneamino)phenyl]-2-[[1-[[4-(trifluoromethyl)phenyl]methoxy]naphthalene-2-carbonyl]amino]propanoic acid (PubChem CID 168751782) has the molecular formula C29H25F3N4O4 and a molecular weight of 550.54 g/mol. Its IUPAC name is (2S)-3-[4-(diaminomethylideneamino)phenyl]-2-[[1-[[4-(trifluoromethyl)phenyl]methoxy]naphthalene-2-carbonyl]amino]propanoic acid.
| Compound Name | (2S)-3-[4-(diaminomethylideneamino)phenyl]-2-[[1-[[4-(trifluoromethyl)phenyl]methoxy]naphthalene-2-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 168751782 |
| Molecular Formula | C29H25F3N4O4 |
| Molecular Weight | 550.54 g/mol |
| Exact Mass | 550.18 |
| IUPAC Name | (2S)-3-[4-(diaminomethylideneamino)phenyl]-2-[[1-[[4-(trifluoromethyl)phenyl]methoxy]naphthalene-2-carbonyl]amino]propanoic acid |
| SMILES | NC(N)=Nc1ccc(C[C@H](NC(=O)c2ccc3ccccc3c2OCc2ccc(C(F)(F)F)cc2)C(=O)O)cc1 |
| InChI | InChI=1S/C29H25F3N4O4/c30-29(31,32)20-10-5-18(6-11-20)16-40-25-22-4-2-1-3-19(22)9-14-23(25)26(37)36-24(27(38)39)15-17-7-12-21(13-8-17)35-28(33)34/h1-14,24H,15-16H2,(H,36,37)(H,38,39)(H4,33,34,35)/t24-/m0/s1 |
| InChIKey | ZEKLKSWLQRDWPC-DEOSSOPVSA-N |
| XLogP | 4.77 |
| TPSA | 140.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.54 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|