C40H47F3N4O9 — CID 176535554
carbon dioxide;[4-[2-[[(2S)-3,3-dimethyl-1-phenylbutan-2-yl]amino]-2-oxoethyl]-3-(trifluoromethyl)phenyl] 4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]benzoate (PubChem CID 176535554) has the molecular formula C40H47F3N4O9 and a molecular weight of 784.83 g/mol. Its IUPAC name is carbon dioxide;[4-[2-[[(2S)-3,3-dimethyl-1-phenylbutan-2-yl]amino]-2-oxoethyl]-3-(trifluoromethyl)phenyl] 4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]benzoate.
| Compound Name | carbon dioxide;[4-[2-[[(2S)-3,3-dimethyl-1-phenylbutan-2-yl]amino]-2-oxoethyl]-3-(trifluoromethyl)phenyl] 4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]benzoate |
|---|---|
| PubChem CID | 176535554 |
| Molecular Formula | C40H47F3N4O9 |
| Molecular Weight | 784.83 g/mol |
| Exact Mass | 784.33 |
| IUPAC Name | carbon dioxide;[4-[2-[[(2S)-3,3-dimethyl-1-phenylbutan-2-yl]amino]-2-oxoethyl]-3-(trifluoromethyl)phenyl] 4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]benzoate |
| SMILES | CC(C)(C)OC(=O)NC(=Nc1ccc(C(=O)Oc2ccc(CC(=O)N[C@@H](Cc3ccccc3)C(C)(C)C)c(C(F)(F)F)c2)cc1)NC(=O)OC(C)(C)C.O=C=O |
| InChI | InChI=1S/C39H47F3N4O7.CO2/c1-36(2,3)30(21-24-13-11-10-12-14-24)44-31(47)22-26-17-20-28(23-29(26)39(40,41)42)51-32(48)25-15-18-27(19-16-25)43-33(45-34(49)52-37(4,5)6)46-35(50)53-38(7,8)9;2-1-3/h10-20,23,30H,21-22H2,1-9H3,(H,44,47)(H2,43,45,46,49,50);/t30-;/m0./s1 |
| InChIKey | IPNYLTXMVZMLBI-CZCBIWLKSA-N |
| XLogP | 7.69 |
| TPSA | 178.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.83 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|