C34H40N4O9 — CID 142432157
[4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]phenyl] 4-[2-(phenylmethoxycarbonylamino)ethoxy]benzoate (PubChem CID 142432157) has the molecular formula C34H40N4O9 and a molecular weight of 648.71 g/mol. Its IUPAC name is [4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]phenyl] 4-[2-(phenylmethoxycarbonylamino)ethoxy]benzoate.
| Compound Name | [4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]phenyl] 4-[2-(phenylmethoxycarbonylamino)ethoxy]benzoate |
|---|---|
| PubChem CID | 142432157 |
| Molecular Formula | C34H40N4O9 |
| Molecular Weight | 648.71 g/mol |
| Exact Mass | 648.28 |
| IUPAC Name | [4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]phenyl] 4-[2-(phenylmethoxycarbonylamino)ethoxy]benzoate |
| SMILES | CC(C)(C)OC(=O)NC(=Nc1ccc(OC(=O)c2ccc(OCCNC(=O)OCc3ccccc3)cc2)cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C34H40N4O9/c1-33(2,3)46-31(41)37-29(38-32(42)47-34(4,5)6)36-25-14-18-27(19-15-25)45-28(39)24-12-16-26(17-13-24)43-21-20-35-30(40)44-22-23-10-8-7-9-11-23/h7-19H,20-22H2,1-6H3,(H,35,40)(H2,36,37,38,41,42) |
| InChIKey | OPAXXKMJLOUXAU-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 162.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.71 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|