C33H37N5O9 — CID 135480420
[4-[bis(phenylmethoxycarbonylamino)methylideneamino]phenyl] (2S)-5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate (PubChem CID 135480420) has the molecular formula C33H37N5O9 and a molecular weight of 647.69 g/mol. Its IUPAC name is [4-[bis(phenylmethoxycarbonylamino)methylideneamino]phenyl] (2S)-5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate.
| Compound Name | [4-[bis(phenylmethoxycarbonylamino)methylideneamino]phenyl] (2S)-5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate |
|---|---|
| PubChem CID | 135480420 |
| Molecular Formula | C33H37N5O9 |
| Molecular Weight | 647.69 g/mol |
| Exact Mass | 647.26 |
| IUPAC Name | [4-[bis(phenylmethoxycarbonylamino)methylideneamino]phenyl] (2S)-5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCC(N)=O)C(=O)Oc1ccc(N=C(NC(=O)OCc2ccccc2)NC(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C33H37N5O9/c1-33(2,3)47-32(43)36-26(18-19-27(34)39)28(40)46-25-16-14-24(15-17-25)35-29(37-30(41)44-20-22-10-6-4-7-11-22)38-31(42)45-21-23-12-8-5-9-13-23/h4-17,26H,18-21H2,1-3H3,(H2,34,39)(H,36,43)(H2,35,37,38,41,42)/t26-/m0/s1 |
| InChIKey | AFNFLJHAKOVRMO-SANMLTNESA-N |
| XLogP | 4.59 |
| TPSA | 196.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.69 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|