C29H35F3N4O8 — CID 135404284
[4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]phenyl] 3,3,3-trifluoro-2-methyl-2-(phenylmethoxycarbonylamino)propanoate (PubChem CID 135404284) has the molecular formula C29H35F3N4O8 and a molecular weight of 624.61 g/mol. Its IUPAC name is [4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]phenyl] 3,3,3-trifluoro-2-methyl-2-(phenylmethoxycarbonylamino)propanoate.
| Compound Name | [4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]phenyl] 3,3,3-trifluoro-2-methyl-2-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 135404284 |
| Molecular Formula | C29H35F3N4O8 |
| Molecular Weight | 624.61 g/mol |
| Exact Mass | 624.24 |
| IUPAC Name | [4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]phenyl] 3,3,3-trifluoro-2-methyl-2-(phenylmethoxycarbonylamino)propanoate |
| SMILES | CC(C)(C)OC(=O)NC(=Nc1ccc(OC(=O)C(C)(NC(=O)OCc2ccccc2)C(F)(F)F)cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H35F3N4O8/c1-26(2,3)43-23(38)34-22(35-24(39)44-27(4,5)6)33-19-13-15-20(16-14-19)42-21(37)28(7,29(30,31)32)36-25(40)41-17-18-11-9-8-10-12-18/h8-16H,17H2,1-7H3,(H,36,40)(H2,33,34,35,38,39) |
| InChIKey | WDWPKMFIOWJGKF-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 153.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.61 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|