C35H36N4O8 — CID 135424063
[5-[bis(phenylmethoxycarbonylamino)methylideneamino]naphthalen-2-yl] 3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 135424063) has the molecular formula C35H36N4O8 and a molecular weight of 640.69 g/mol. Its IUPAC name is [5-[bis(phenylmethoxycarbonylamino)methylideneamino]naphthalen-2-yl] 3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | [5-[bis(phenylmethoxycarbonylamino)methylideneamino]naphthalen-2-yl] 3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 135424063 |
| Molecular Formula | C35H36N4O8 |
| Molecular Weight | 640.69 g/mol |
| Exact Mass | 640.25 |
| IUPAC Name | [5-[bis(phenylmethoxycarbonylamino)methylideneamino]naphthalen-2-yl] 3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | CC(C)(C)OC(=O)NCCC(=O)Oc1ccc2c(N=C(NC(=O)OCc3ccccc3)NC(=O)OCc3ccccc3)cccc2c1 |
| InChI | InChI=1S/C35H36N4O8/c1-35(2,3)47-32(41)36-20-19-30(40)46-27-17-18-28-26(21-27)15-10-16-29(28)37-31(38-33(42)44-22-24-11-6-4-7-12-24)39-34(43)45-23-25-13-8-5-9-14-25/h4-18,21H,19-20,22-23H2,1-3H3,(H,36,41)(H2,37,38,39,42,43) |
| InChIKey | MFSUTLMUSFUCDU-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 153.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.69 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|