C43H51N6O11P — CID 135541893
benzyl N-[1-bis(4-acetamidophenoxy)phosphoryl-2-[4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]phenyl]ethyl]carbamate (PubChem CID 135541893) has the molecular formula C43H51N6O11P and a molecular weight of 858.89 g/mol. Its IUPAC name is benzyl N-[1-bis(4-acetamidophenoxy)phosphoryl-2-[4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]phenyl]ethyl]carbamate.
| Compound Name | benzyl N-[1-bis(4-acetamidophenoxy)phosphoryl-2-[4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 135541893 |
| Molecular Formula | C43H51N6O11P |
| Molecular Weight | 858.89 g/mol |
| Exact Mass | 858.34 |
| IUPAC Name | benzyl N-[1-bis(4-acetamidophenoxy)phosphoryl-2-[4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]phenyl]ethyl]carbamate |
| SMILES | CC(=O)Nc1ccc(OP(=O)(Oc2ccc(NC(C)=O)cc2)C(Cc2ccc(N=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)cc2)NC(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C43H51N6O11P/c1-28(50)44-32-18-22-35(23-19-32)59-61(55,60-36-24-20-33(21-25-36)45-29(2)51)37(47-39(52)56-27-31-12-10-9-11-13-31)26-30-14-16-34(17-15-30)46-38(48-40(53)57-42(3,4)5)49-41(54)58-43(6,7)8/h9-25,37H,26-27H2,1-8H3,(H,44,50)(H,45,51)(H,47,52)(H2,46,48,49,53,54) |
| InChIKey | OFNJPRDIJLBKSD-UHFFFAOYSA-N |
| XLogP | 8.79 |
| TPSA | 221.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 858.89 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|