C29H24F5N4O5P — CID 155537767
(2,3,4,5,6-pentafluorophenyl)methyl N-[2-[4-(diaminomethylideneamino)phenyl]-1-diphenoxyphosphorylethyl]carbamate (PubChem CID 155537767) has the molecular formula C29H24F5N4O5P and a molecular weight of 634.50 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl)methyl N-[2-[4-(diaminomethylideneamino)phenyl]-1-diphenoxyphosphorylethyl]carbamate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl)methyl N-[2-[4-(diaminomethylideneamino)phenyl]-1-diphenoxyphosphorylethyl]carbamate |
|---|---|
| PubChem CID | 155537767 |
| Molecular Formula | C29H24F5N4O5P |
| Molecular Weight | 634.50 g/mol |
| Exact Mass | 634.14 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl)methyl N-[2-[4-(diaminomethylideneamino)phenyl]-1-diphenoxyphosphorylethyl]carbamate |
| SMILES | NC(N)=Nc1ccc(CC(NC(=O)OCc2c(F)c(F)c(F)c(F)c2F)P(=O)(Oc2ccccc2)Oc2ccccc2)cc1 |
| InChI | InChI=1S/C29H24F5N4O5P/c30-23-21(24(31)26(33)27(34)25(23)32)16-41-29(39)38-22(15-17-11-13-18(14-12-17)37-28(35)36)44(40,42-19-7-3-1-4-8-19)43-20-9-5-2-6-10-20/h1-14,22H,15-16H2,(H,38,39)(H4,35,36,37) |
| InChIKey | HGOGNMJXWYXAIZ-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 138.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.50 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|