C29H30F3N4O8P — CID 90006451
2-prop-2-ynoxyethyl N-[2-[4-(diaminomethylideneamino)phenyl]-1-diphenoxyphosphorylethyl]carbamate;2,2,2-trifluoroacetic acid (PubChem CID 90006451) has the molecular formula C29H30F3N4O8P and a molecular weight of 650.55 g/mol. Its IUPAC name is 2-prop-2-ynoxyethyl N-[2-[4-(diaminomethylideneamino)phenyl]-1-diphenoxyphosphorylethyl]carbamate;2,2,2-trifluoroacetic acid.
| Compound Name | 2-prop-2-ynoxyethyl N-[2-[4-(diaminomethylideneamino)phenyl]-1-diphenoxyphosphorylethyl]carbamate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 90006451 |
| Molecular Formula | C29H30F3N4O8P |
| Molecular Weight | 650.55 g/mol |
| Exact Mass | 650.18 |
| IUPAC Name | 2-prop-2-ynoxyethyl N-[2-[4-(diaminomethylideneamino)phenyl]-1-diphenoxyphosphorylethyl]carbamate;2,2,2-trifluoroacetic acid |
| SMILES | C#CCOCCOC(=O)NC(Cc1ccc(N=C(N)N)cc1)P(=O)(Oc1ccccc1)Oc1ccccc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C27H29N4O6P.C2HF3O2/c1-2-17-34-18-19-35-27(32)31-25(20-21-13-15-22(16-14-21)30-26(28)29)38(33,36-23-9-5-3-6-10-23)37-24-11-7-4-8-12-24;3-2(4,5)1(6)7/h1,3-16,25H,17-20H2,(H,31,32)(H4,28,29,30);(H,6,7) |
| InChIKey | ZDNVAAQBILETOQ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 184.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.55 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|