C32H39F3N7O10P — CID 89158536
2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl N-[2-[4-(diaminomethylideneamino)phenyl]-1-diphenoxyphosphorylethyl]carbamate;2,2,2-trifluoroacetic acid (PubChem CID 89158536) has the molecular formula C32H39F3N7O10P and a molecular weight of 769.67 g/mol. Its IUPAC name is 2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl N-[2-[4-(diaminomethylideneamino)phenyl]-1-diphenoxyphosphorylethyl]carbamate;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl N-[2-[4-(diaminomethylideneamino)phenyl]-1-diphenoxyphosphorylethyl]carbamate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 89158536 |
| Molecular Formula | C32H39F3N7O10P |
| Molecular Weight | 769.67 g/mol |
| Exact Mass | 769.24 |
| IUPAC Name | 2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl N-[2-[4-(diaminomethylideneamino)phenyl]-1-diphenoxyphosphorylethyl]carbamate;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[N-]=[N+]=NCCOCCOCCOCCOC(=O)NC(Cc1ccc(N=C(N)N)cc1)P(=O)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C30H38N7O8P.C2HF3O2/c31-29(32)35-25-13-11-24(12-14-25)23-28(36-30(38)43-22-21-42-20-19-41-18-17-40-16-15-34-37-33)46(39,44-26-7-3-1-4-8-26)45-27-9-5-2-6-10-27;3-2(4,5)1(6)7/h1-14,28H,15-23H2,(H,36,38)(H4,31,32,35);(H,6,7) |
| InChIKey | JVFRGPWFYRBKDA-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 252.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.67 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|