C23H22F3N4O7P — CID 118395390
[4-(diaminomethylideneamino)phenyl]methyl-diphenoxyphosphorylcarbamic acid;2,2,2-trifluoroacetic acid (PubChem CID 118395390) has the molecular formula C23H22F3N4O7P and a molecular weight of 554.42 g/mol. Its IUPAC name is [4-(diaminomethylideneamino)phenyl]methyl-diphenoxyphosphorylcarbamic acid;2,2,2-trifluoroacetic acid.
| Compound Name | [4-(diaminomethylideneamino)phenyl]methyl-diphenoxyphosphorylcarbamic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118395390 |
| Molecular Formula | C23H22F3N4O7P |
| Molecular Weight | 554.42 g/mol |
| Exact Mass | 554.12 |
| IUPAC Name | [4-(diaminomethylideneamino)phenyl]methyl-diphenoxyphosphorylcarbamic acid;2,2,2-trifluoroacetic acid |
| SMILES | NC(N)=Nc1ccc(CN(C(=O)O)P(=O)(Oc2ccccc2)Oc2ccccc2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H21N4O5P.C2HF3O2/c22-20(23)24-17-13-11-16(12-14-17)15-25(21(26)27)31(28,29-18-7-3-1-4-8-18)30-19-9-5-2-6-10-19;3-2(4,5)1(6)7/h1-14H,15H2,(H,26,27)(H4,22,23,24);(H,6,7) |
| InChIKey | XWXSYHFAHJCBHY-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 177.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.42 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|