C35H39N6O7P — CID 73238261
N-[1-[[1-[[2-[4-(diaminomethylideneamino)phenyl]-1-diphenoxyphosphorylethyl]amino]-1-oxopropan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]-2-methylbenzamide (PubChem CID 73238261) has the molecular formula C35H39N6O7P and a molecular weight of 686.71 g/mol. Its IUPAC name is N-[1-[[1-[[2-[4-(diaminomethylideneamino)phenyl]-1-diphenoxyphosphorylethyl]amino]-1-oxopropan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]-2-methylbenzamide.
| Compound Name | N-[1-[[1-[[2-[4-(diaminomethylideneamino)phenyl]-1-diphenoxyphosphorylethyl]amino]-1-oxopropan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]-2-methylbenzamide |
|---|---|
| PubChem CID | 73238261 |
| Molecular Formula | C35H39N6O7P |
| Molecular Weight | 686.71 g/mol |
| Exact Mass | 686.26 |
| IUPAC Name | N-[1-[[1-[[2-[4-(diaminomethylideneamino)phenyl]-1-diphenoxyphosphorylethyl]amino]-1-oxopropan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]-2-methylbenzamide |
| SMILES | Cc1ccccc1C(=O)NC(CO)C(=O)NC(C)C(=O)NC(Cc1ccc(N=C(N)N)cc1)P(=O)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C35H39N6O7P/c1-23-11-9-10-16-29(23)33(44)40-30(22-42)34(45)38-24(2)32(43)41-31(21-25-17-19-26(20-18-25)39-35(36)37)49(46,47-27-12-5-3-6-13-27)48-28-14-7-4-8-15-28/h3-20,24,30-31,42H,21-22H2,1-2H3,(H,38,45)(H,40,44)(H,41,43)(H4,36,37,39) |
| InChIKey | TYRZSNKCILDHRL-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 207.46 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.71 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|