C29H31N5O6 — CID 53350169
(2S)-2-[[(2S)-2-[[(2S)-3-hydroxy-2-[[2-(4-phenyldiazenylphenyl)acetyl]amino]propanoyl]amino]-3-phenylpropanoyl]amino]propanoic acid (PubChem CID 53350169) has the molecular formula C29H31N5O6 and a molecular weight of 545.60 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S)-3-hydroxy-2-[[2-(4-phenyldiazenylphenyl)acetyl]amino]propanoyl]amino]-3-phenylpropanoyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S)-3-hydroxy-2-[[2-(4-phenyldiazenylphenyl)acetyl]amino]propanoyl]amino]-3-phenylpropanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 53350169 |
| Molecular Formula | C29H31N5O6 |
| Molecular Weight | 545.60 g/mol |
| Exact Mass | 545.23 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-3-hydroxy-2-[[2-(4-phenyldiazenylphenyl)acetyl]amino]propanoyl]amino]-3-phenylpropanoyl]amino]propanoic acid |
| SMILES | C[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CO)NC(=O)Cc1ccc(/N=N/c2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C29H31N5O6/c1-19(29(39)40)30-27(37)24(16-20-8-4-2-5-9-20)32-28(38)25(18-35)31-26(36)17-21-12-14-23(15-13-21)34-33-22-10-6-3-7-11-22/h2-15,19,24-25,35H,16-18H2,1H3,(H,30,37)(H,31,36)(H,32,38)(H,39,40)/b34-33+/t19-,24-,25-/m0/s1 |
| InChIKey | PUERLLUQQYNLJS-PFYBPZRQSA-N |
| XLogP | 2.44 |
| TPSA | 169.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.60 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|