C31H35N5O7 — CID 53348770
(2S)-2-[[(2S)-3-hydroxy-2-[[(2S)-3-(4-hydroxyphenyl)-2-[[2-(4-phenyldiazenylphenyl)acetyl]amino]propanoyl]amino]propanoyl]amino]-3-methylbutanoic acid (PubChem CID 53348770) has the molecular formula C31H35N5O7 and a molecular weight of 589.65 g/mol. Its IUPAC name is (2S)-2-[[(2S)-3-hydroxy-2-[[(2S)-3-(4-hydroxyphenyl)-2-[[2-(4-phenyldiazenylphenyl)acetyl]amino]propanoyl]amino]propanoyl]amino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[[(2S)-3-hydroxy-2-[[(2S)-3-(4-hydroxyphenyl)-2-[[2-(4-phenyldiazenylphenyl)acetyl]amino]propanoyl]amino]propanoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 53348770 |
| Molecular Formula | C31H35N5O7 |
| Molecular Weight | 589.65 g/mol |
| Exact Mass | 589.25 |
| IUPAC Name | (2S)-2-[[(2S)-3-hydroxy-2-[[(2S)-3-(4-hydroxyphenyl)-2-[[2-(4-phenyldiazenylphenyl)acetyl]amino]propanoyl]amino]propanoyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@H](NC(=O)[C@H](CO)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)Cc1ccc(/N=N/c2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C31H35N5O7/c1-19(2)28(31(42)43)34-30(41)26(18-37)33-29(40)25(16-20-10-14-24(38)15-11-20)32-27(39)17-21-8-12-23(13-9-21)36-35-22-6-4-3-5-7-22/h3-15,19,25-26,28,37-38H,16-18H2,1-2H3,(H,32,39)(H,33,40)(H,34,41)(H,42,43)/b36-35+/t25-,26-,28-/m0/s1 |
| InChIKey | RZDYVQXKLGOTRI-NEOORCFWSA-N |
| XLogP | 2.78 |
| TPSA | 189.78 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.65 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|