C21H22BrN3O4 — CID 138480856
3-[[(2S)-3-(4-bromophenyl)-2-[(2-phenylacetyl)amino]propanoyl]amino]-2-oxobutanamide (PubChem CID 138480856) has the molecular formula C21H22BrN3O4 and a molecular weight of 460.33 g/mol. Its IUPAC name is 3-[[(2S)-3-(4-bromophenyl)-2-[(2-phenylacetyl)amino]propanoyl]amino]-2-oxobutanamide.
| Compound Name | 3-[[(2S)-3-(4-bromophenyl)-2-[(2-phenylacetyl)amino]propanoyl]amino]-2-oxobutanamide |
|---|---|
| PubChem CID | 138480856 |
| Molecular Formula | C21H22BrN3O4 |
| Molecular Weight | 460.33 g/mol |
| Exact Mass | 459.08 |
| IUPAC Name | 3-[[(2S)-3-(4-bromophenyl)-2-[(2-phenylacetyl)amino]propanoyl]amino]-2-oxobutanamide |
| SMILES | CC(NC(=O)[C@H](Cc1ccc(Br)cc1)NC(=O)Cc1ccccc1)C(=O)C(N)=O |
| InChI | InChI=1S/C21H22BrN3O4/c1-13(19(27)20(23)28)24-21(29)17(11-15-7-9-16(22)10-8-15)25-18(26)12-14-5-3-2-4-6-14/h2-10,13,17H,11-12H2,1H3,(H2,23,28)(H,24,29)(H,25,26)/t13?,17-/m0/s1 |
| InChIKey | AXDSHFRACVMJRY-RUINGEJQSA-N |
| XLogP | 1.28 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.33 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|