C30H39N5O6 — CID 138470691
(2S)-N-(1-amino-2-methyl-1-oxopropan-2-yl)-2-[[2-oxo-3-[[3-phenyl-2-[(2-phenylacetyl)amino]propanoyl]amino]butanoyl]amino]pentanamide (PubChem CID 138470691) has the molecular formula C30H39N5O6 and a molecular weight of 565.67 g/mol. Its IUPAC name is (2S)-N-(1-amino-2-methyl-1-oxopropan-2-yl)-2-[[2-oxo-3-[[3-phenyl-2-[(2-phenylacetyl)amino]propanoyl]amino]butanoyl]amino]pentanamide.
| Compound Name | (2S)-N-(1-amino-2-methyl-1-oxopropan-2-yl)-2-[[2-oxo-3-[[3-phenyl-2-[(2-phenylacetyl)amino]propanoyl]amino]butanoyl]amino]pentanamide |
|---|---|
| PubChem CID | 138470691 |
| Molecular Formula | C30H39N5O6 |
| Molecular Weight | 565.67 g/mol |
| Exact Mass | 565.29 |
| IUPAC Name | (2S)-N-(1-amino-2-methyl-1-oxopropan-2-yl)-2-[[2-oxo-3-[[3-phenyl-2-[(2-phenylacetyl)amino]propanoyl]amino]butanoyl]amino]pentanamide |
| SMILES | CCC[C@H](NC(=O)C(=O)C(C)NC(=O)C(Cc1ccccc1)NC(=O)Cc1ccccc1)C(=O)NC(C)(C)C(N)=O |
| InChI | InChI=1S/C30H39N5O6/c1-5-12-22(27(39)35-30(3,4)29(31)41)34-28(40)25(37)19(2)32-26(38)23(17-20-13-8-6-9-14-20)33-24(36)18-21-15-10-7-11-16-21/h6-11,13-16,19,22-23H,5,12,17-18H2,1-4H3,(H2,31,41)(H,32,38)(H,33,36)(H,34,40)(H,35,39)/t19?,22-,23?/m0/s1 |
| InChIKey | MMINWEIZNQLOTQ-UTCTYZAISA-N |
| XLogP | 0.70 |
| TPSA | 176.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.67 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|