C32H39F3N4O7 — CID 138480847
2-methyl-2-[[(3S)-3-methyl-2-[[2-oxo-3-[[(2S)-2-[(2-phenylacetyl)amino]-3-[3-(trifluoromethyl)phenyl]propanoyl]amino]butanoyl]amino]pentanoyl]amino]propanoic acid (PubChem CID 138480847) has the molecular formula C32H39F3N4O7 and a molecular weight of 648.68 g/mol. Its IUPAC name is 2-methyl-2-[[(3S)-3-methyl-2-[[2-oxo-3-[[(2S)-2-[(2-phenylacetyl)amino]-3-[3-(trifluoromethyl)phenyl]propanoyl]amino]butanoyl]amino]pentanoyl]amino]propanoic acid.
| Compound Name | 2-methyl-2-[[(3S)-3-methyl-2-[[2-oxo-3-[[(2S)-2-[(2-phenylacetyl)amino]-3-[3-(trifluoromethyl)phenyl]propanoyl]amino]butanoyl]amino]pentanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 138480847 |
| Molecular Formula | C32H39F3N4O7 |
| Molecular Weight | 648.68 g/mol |
| Exact Mass | 648.28 |
| IUPAC Name | 2-methyl-2-[[(3S)-3-methyl-2-[[2-oxo-3-[[(2S)-2-[(2-phenylacetyl)amino]-3-[3-(trifluoromethyl)phenyl]propanoyl]amino]butanoyl]amino]pentanoyl]amino]propanoic acid |
| SMILES | CC[C@H](C)C(NC(=O)C(=O)C(C)NC(=O)[C@H](Cc1cccc(C(F)(F)F)c1)NC(=O)Cc1ccccc1)C(=O)NC(C)(C)C(=O)O |
| InChI | InChI=1S/C32H39F3N4O7/c1-6-18(2)25(28(43)39-31(4,5)30(45)46)38-29(44)26(41)19(3)36-27(42)23(37-24(40)17-20-11-8-7-9-12-20)16-21-13-10-14-22(15-21)32(33,34)35/h7-15,18-19,23,25H,6,16-17H2,1-5H3,(H,36,42)(H,37,40)(H,38,44)(H,39,43)(H,45,46)/t18-,19?,23-,25?/m0/s1 |
| InChIKey | WIORIPNSCHKRCT-GCZRHQKFSA-N |
| XLogP | 2.56 |
| TPSA | 170.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.68 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|