C28H35N3O6 — CID 138480863
2-methyl-2-[[(2S,3S)-3-methyl-2-[[2-oxo-4-phenyl-3-[(2-phenylacetyl)amino]butanoyl]amino]pentanoyl]amino]propanoic acid (PubChem CID 138480863) has the molecular formula C28H35N3O6 and a molecular weight of 509.60 g/mol. Its IUPAC name is 2-methyl-2-[[(2S,3S)-3-methyl-2-[[2-oxo-4-phenyl-3-[(2-phenylacetyl)amino]butanoyl]amino]pentanoyl]amino]propanoic acid.
| Compound Name | 2-methyl-2-[[(2S,3S)-3-methyl-2-[[2-oxo-4-phenyl-3-[(2-phenylacetyl)amino]butanoyl]amino]pentanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 138480863 |
| Molecular Formula | C28H35N3O6 |
| Molecular Weight | 509.60 g/mol |
| Exact Mass | 509.25 |
| IUPAC Name | 2-methyl-2-[[(2S,3S)-3-methyl-2-[[2-oxo-4-phenyl-3-[(2-phenylacetyl)amino]butanoyl]amino]pentanoyl]amino]propanoic acid |
| SMILES | CC[C@H](C)[C@H](NC(=O)C(=O)C(Cc1ccccc1)NC(=O)Cc1ccccc1)C(=O)NC(C)(C)C(=O)O |
| InChI | InChI=1S/C28H35N3O6/c1-5-18(2)23(25(34)31-28(3,4)27(36)37)30-26(35)24(33)21(16-19-12-8-6-9-13-19)29-22(32)17-20-14-10-7-11-15-20/h6-15,18,21,23H,5,16-17H2,1-4H3,(H,29,32)(H,30,35)(H,31,34)(H,36,37)/t18-,21?,23-/m0/s1 |
| InChIKey | PIVBGOLFVVPRPA-IAZWUMQMSA-N |
| XLogP | 2.04 |
| TPSA | 141.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.60 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|