C33H42N2O7 — CID 147780233
(5S,6S)-5-[[(7S)-2,6-dioxo-8-phenyl-7-[(2-phenylacetyl)amino]octanoyl]amino]-2,2,6-trimethyl-4-oxooctanoic acid (PubChem CID 147780233) has the molecular formula C33H42N2O7 and a molecular weight of 578.71 g/mol. Its IUPAC name is (5S,6S)-5-[[(7S)-2,6-dioxo-8-phenyl-7-[(2-phenylacetyl)amino]octanoyl]amino]-2,2,6-trimethyl-4-oxooctanoic acid.
| Compound Name | (5S,6S)-5-[[(7S)-2,6-dioxo-8-phenyl-7-[(2-phenylacetyl)amino]octanoyl]amino]-2,2,6-trimethyl-4-oxooctanoic acid |
|---|---|
| PubChem CID | 147780233 |
| Molecular Formula | C33H42N2O7 |
| Molecular Weight | 578.71 g/mol |
| Exact Mass | 578.30 |
| IUPAC Name | (5S,6S)-5-[[(7S)-2,6-dioxo-8-phenyl-7-[(2-phenylacetyl)amino]octanoyl]amino]-2,2,6-trimethyl-4-oxooctanoic acid |
| SMILES | CC[C@H](C)[C@H](NC(=O)C(=O)CCCC(=O)[C@H](Cc1ccccc1)NC(=O)Cc1ccccc1)C(=O)CC(C)(C)C(=O)O |
| InChI | InChI=1S/C33H42N2O7/c1-5-22(2)30(28(38)21-33(3,4)32(41)42)35-31(40)27(37)18-12-17-26(36)25(19-23-13-8-6-9-14-23)34-29(39)20-24-15-10-7-11-16-24/h6-11,13-16,22,25,30H,5,12,17-21H2,1-4H3,(H,34,39)(H,35,40)(H,41,42)/t22-,25-,30-/m0/s1 |
| InChIKey | HHQMTZBJYRIALZ-ZSHJDDHQSA-N |
| XLogP | 3.87 |
| TPSA | 146.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.71 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|