C28H29NO4 — CID 162042256
methyl (2R,5S)-2-benzyl-4-oxo-6-phenyl-5-[(2-phenylacetyl)amino]hexanoate (PubChem CID 162042256) has the molecular formula C28H29NO4 and a molecular weight of 443.54 g/mol. Its IUPAC name is methyl (2R,5S)-2-benzyl-4-oxo-6-phenyl-5-[(2-phenylacetyl)amino]hexanoate.
| Compound Name | methyl (2R,5S)-2-benzyl-4-oxo-6-phenyl-5-[(2-phenylacetyl)amino]hexanoate |
|---|---|
| PubChem CID | 162042256 |
| Molecular Formula | C28H29NO4 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | methyl (2R,5S)-2-benzyl-4-oxo-6-phenyl-5-[(2-phenylacetyl)amino]hexanoate |
| SMILES | COC(=O)[C@@H](CC(=O)[C@H](Cc1ccccc1)NC(=O)Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C28H29NO4/c1-33-28(32)24(17-21-11-5-2-6-12-21)20-26(30)25(18-22-13-7-3-8-14-22)29-27(31)19-23-15-9-4-10-16-23/h2-16,24-25H,17-20H2,1H3,(H,29,31)/t24-,25+/m1/s1 |
| InChIKey | KTOIDYKWXPGFGB-RPBOFIJWSA-N |
| XLogP | 3.95 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |