C25H30N2O8 — CID 160779487
methyl (2R,5S)-2-benzyl-6-(4-hydroxy-3-nitrophenyl)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxohexanoate (PubChem CID 160779487) has the molecular formula C25H30N2O8 and a molecular weight of 486.52 g/mol. Its IUPAC name is methyl (2R,5S)-2-benzyl-6-(4-hydroxy-3-nitrophenyl)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxohexanoate.
| Compound Name | methyl (2R,5S)-2-benzyl-6-(4-hydroxy-3-nitrophenyl)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxohexanoate |
|---|---|
| PubChem CID | 160779487 |
| Molecular Formula | C25H30N2O8 |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | methyl (2R,5S)-2-benzyl-6-(4-hydroxy-3-nitrophenyl)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxohexanoate |
| SMILES | COC(=O)[C@@H](CC(=O)[C@H](Cc1ccc(O)c([N+](=O)[O-])c1)NC(=O)OC(C)(C)C)Cc1ccccc1 |
| InChI | InChI=1S/C25H30N2O8/c1-25(2,3)35-24(31)26-19(13-17-10-11-21(28)20(14-17)27(32)33)22(29)15-18(23(30)34-4)12-16-8-6-5-7-9-16/h5-11,14,18-19,28H,12-13,15H2,1-4H3,(H,26,31)/t18-,19+/m1/s1 |
| InChIKey | UGKOCKGXVTXYNG-MOPGFXCFSA-N |
| XLogP | 3.73 |
| TPSA | 145.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|