C15H21N2O7P — CID 175078693
methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(3-nitro-4-phosphanyloxyphenyl)propanoate (PubChem CID 175078693) has the molecular formula C15H21N2O7P and a molecular weight of 372.31 g/mol. Its IUPAC name is methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(3-nitro-4-phosphanyloxyphenyl)propanoate.
| Compound Name | methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(3-nitro-4-phosphanyloxyphenyl)propanoate |
|---|---|
| PubChem CID | 175078693 |
| Molecular Formula | C15H21N2O7P |
| Molecular Weight | 372.31 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(3-nitro-4-phosphanyloxyphenyl)propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(OP)c([N+](=O)[O-])c1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H21N2O7P/c1-15(2,3)23-14(19)16-10(13(18)22-4)7-9-5-6-12(24-25)11(8-9)17(20)21/h5-6,8,10H,7,25H2,1-4H3,(H,16,19)/t10-/m0/s1 |
| InChIKey | RMEHVKJWUMDDOK-JTQLQIEISA-N |
| XLogP | 2.37 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.31 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|