C24H28FN3O9 — CID 11260938
methyl (2R)-3-(4-fluoro-3-nitrophenyl)-2-[[(2R)-2-(3-hydroxy-4-methoxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]propanoate (PubChem CID 11260938) has the molecular formula C24H28FN3O9 and a molecular weight of 521.50 g/mol. Its IUPAC name is methyl (2R)-3-(4-fluoro-3-nitrophenyl)-2-[[(2R)-2-(3-hydroxy-4-methoxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]propanoate.
| Compound Name | methyl (2R)-3-(4-fluoro-3-nitrophenyl)-2-[[(2R)-2-(3-hydroxy-4-methoxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]propanoate |
|---|---|
| PubChem CID | 11260938 |
| Molecular Formula | C24H28FN3O9 |
| Molecular Weight | 521.50 g/mol |
| Exact Mass | 521.18 |
| IUPAC Name | methyl (2R)-3-(4-fluoro-3-nitrophenyl)-2-[[(2R)-2-(3-hydroxy-4-methoxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]propanoate |
| SMILES | COC(=O)[C@@H](Cc1ccc(F)c([N+](=O)[O-])c1)NC(=O)[C@H](NC(=O)OC(C)(C)C)c1ccc(OC)c(O)c1 |
| InChI | InChI=1S/C24H28FN3O9/c1-24(2,3)37-23(32)27-20(14-7-9-19(35-4)18(29)12-14)21(30)26-16(22(31)36-5)10-13-6-8-15(25)17(11-13)28(33)34/h6-9,11-12,16,20,29H,10H2,1-5H3,(H,26,30)(H,27,32)/t16-,20-/m1/s1 |
| InChIKey | QUDGQPXTCRTQTN-OXQOHEQNSA-N |
| XLogP | 2.91 |
| TPSA | 166.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.50 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|