C16H19F3N2O8S — CID 67807639
methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[3-nitro-4-(trifluoromethylsulfonyl)phenyl]propanoate (PubChem CID 67807639) has the molecular formula C16H19F3N2O8S and a molecular weight of 456.40 g/mol. Its IUPAC name is methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[3-nitro-4-(trifluoromethylsulfonyl)phenyl]propanoate.
| Compound Name | methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[3-nitro-4-(trifluoromethylsulfonyl)phenyl]propanoate |
|---|---|
| PubChem CID | 67807639 |
| Molecular Formula | C16H19F3N2O8S |
| Molecular Weight | 456.40 g/mol |
| Exact Mass | 456.08 |
| IUPAC Name | methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[3-nitro-4-(trifluoromethylsulfonyl)phenyl]propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(S(=O)(=O)C(F)(F)F)c([N+](=O)[O-])c1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H19F3N2O8S/c1-15(2,3)29-14(23)20-10(13(22)28-4)7-9-5-6-12(11(8-9)21(24)25)30(26,27)16(17,18)19/h5-6,8,10H,7H2,1-4H3,(H,20,23)/t10-/m0/s1 |
| InChIKey | VNQPAEHFCQXENS-JTQLQIEISA-N |
| XLogP | 2.50 |
| TPSA | 141.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.40 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|