C22H24N2O9 — CID 170880648
3-[4-(2-methoxycarbonylphenoxy)-3-nitrophenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (PubChem CID 170880648) has the molecular formula C22H24N2O9 and a molecular weight of 460.44 g/mol. Its IUPAC name is 3-[4-(2-methoxycarbonylphenoxy)-3-nitrophenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid.
| Compound Name | 3-[4-(2-methoxycarbonylphenoxy)-3-nitrophenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| PubChem CID | 170880648 |
| Molecular Formula | C22H24N2O9 |
| Molecular Weight | 460.44 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | 3-[4-(2-methoxycarbonylphenoxy)-3-nitrophenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| SMILES | COC(=O)c1ccccc1Oc1ccc(CC(NC(=O)OC(C)(C)C)C(=O)O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H24N2O9/c1-22(2,3)33-21(28)23-15(19(25)26)11-13-9-10-18(16(12-13)24(29)30)32-17-8-6-5-7-14(17)20(27)31-4/h5-10,12,15H,11H2,1-4H3,(H,23,28)(H,25,26) |
| InChIKey | QCDLOVDRTRJVPF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 154.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.44 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|