C25H32N2O7 — CID 156904046
(4S)-2,2-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(3-nitro-4-phenylmethoxyphenyl)pentanoic acid (PubChem CID 156904046) has the molecular formula C25H32N2O7 and a molecular weight of 472.54 g/mol. Its IUPAC name is (4S)-2,2-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(3-nitro-4-phenylmethoxyphenyl)pentanoic acid.
| Compound Name | (4S)-2,2-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(3-nitro-4-phenylmethoxyphenyl)pentanoic acid |
|---|---|
| PubChem CID | 156904046 |
| Molecular Formula | C25H32N2O7 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | (4S)-2,2-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(3-nitro-4-phenylmethoxyphenyl)pentanoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccc(OCc2ccccc2)c([N+](=O)[O-])c1)CC(C)(C)C(=O)O |
| InChI | InChI=1S/C25H32N2O7/c1-24(2,3)34-23(30)26-19(15-25(4,5)22(28)29)13-18-11-12-21(20(14-18)27(31)32)33-16-17-9-7-6-8-10-17/h6-12,14,19H,13,15-16H2,1-5H3,(H,26,30)(H,28,29)/t19-/m0/s1 |
| InChIKey | OTWFYHNOFXDWTF-IBGZPJMESA-N |
| XLogP | 5.11 |
| TPSA | 128.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|