C30H33N3O9 — CID 164680591
(2S)-2-[[(2S)-3-(4-hydroxy-3-nitrophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-3-(4-phenylmethoxyphenyl)propanoic acid (PubChem CID 164680591) has the molecular formula C30H33N3O9 and a molecular weight of 579.61 g/mol. Its IUPAC name is (2S)-2-[[(2S)-3-(4-hydroxy-3-nitrophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-3-(4-phenylmethoxyphenyl)propanoic acid.
| Compound Name | (2S)-2-[[(2S)-3-(4-hydroxy-3-nitrophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-3-(4-phenylmethoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 164680591 |
| Molecular Formula | C30H33N3O9 |
| Molecular Weight | 579.61 g/mol |
| Exact Mass | 579.22 |
| IUPAC Name | (2S)-2-[[(2S)-3-(4-hydroxy-3-nitrophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-3-(4-phenylmethoxyphenyl)propanoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccc(O)c([N+](=O)[O-])c1)C(=O)N[C@@H](Cc1ccc(OCc2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C30H33N3O9/c1-30(2,3)42-29(38)32-23(16-21-11-14-26(34)25(17-21)33(39)40)27(35)31-24(28(36)37)15-19-9-12-22(13-10-19)41-18-20-7-5-4-6-8-20/h4-14,17,23-24,34H,15-16,18H2,1-3H3,(H,31,35)(H,32,38)(H,36,37)/t23-,24-/m0/s1 |
| InChIKey | IZRZHXBMHRIGGP-ZEQRLZLVSA-N |
| XLogP | 4.13 |
| TPSA | 177.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.61 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|