C15H20N2O7 — CID 69143732
(2S)-2-(2,2-dimethylpropoxycarbonylamino)-3-(4-hydroxy-3-nitrophenyl)propanoic acid (PubChem CID 69143732) has the molecular formula C15H20N2O7 and a molecular weight of 340.33 g/mol. Its IUPAC name is (2S)-2-(2,2-dimethylpropoxycarbonylamino)-3-(4-hydroxy-3-nitrophenyl)propanoic acid.
| Compound Name | (2S)-2-(2,2-dimethylpropoxycarbonylamino)-3-(4-hydroxy-3-nitrophenyl)propanoic acid |
|---|---|
| PubChem CID | 69143732 |
| Molecular Formula | C15H20N2O7 |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | (2S)-2-(2,2-dimethylpropoxycarbonylamino)-3-(4-hydroxy-3-nitrophenyl)propanoic acid |
| SMILES | CC(C)(C)COC(=O)N[C@@H](Cc1ccc(O)c([N+](=O)[O-])c1)C(=O)O |
| InChI | InChI=1S/C15H20N2O7/c1-15(2,3)8-24-14(21)16-10(13(19)20)6-9-4-5-12(18)11(7-9)17(22)23/h4-5,7,10,18H,6,8H2,1-3H3,(H,16,21)(H,19,20)/t10-/m0/s1 |
| InChIKey | OMXZISZDXUYVDR-JTQLQIEISA-N |
| XLogP | 2.07 |
| TPSA | 139.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|