C24H34N2O11 — CID 69144223
2-[(1R)-1-[4-[(2S)-2-(2,2-dimethylpropoxycarbonylamino)-3-ethoxy-3-oxopropyl]-2-nitrophenoxy]butyl]propanedioic acid (PubChem CID 69144223) has the molecular formula C24H34N2O11 and a molecular weight of 526.54 g/mol. Its IUPAC name is 2-[(1R)-1-[4-[(2S)-2-(2,2-dimethylpropoxycarbonylamino)-3-ethoxy-3-oxopropyl]-2-nitrophenoxy]butyl]propanedioic acid.
| Compound Name | 2-[(1R)-1-[4-[(2S)-2-(2,2-dimethylpropoxycarbonylamino)-3-ethoxy-3-oxopropyl]-2-nitrophenoxy]butyl]propanedioic acid |
|---|---|
| PubChem CID | 69144223 |
| Molecular Formula | C24H34N2O11 |
| Molecular Weight | 526.54 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | 2-[(1R)-1-[4-[(2S)-2-(2,2-dimethylpropoxycarbonylamino)-3-ethoxy-3-oxopropyl]-2-nitrophenoxy]butyl]propanedioic acid |
| SMILES | CCC[C@@H](Oc1ccc(C[C@H](NC(=O)OCC(C)(C)C)C(=O)OCC)cc1[N+](=O)[O-])C(C(=O)O)C(=O)O |
| InChI | InChI=1S/C24H34N2O11/c1-6-8-18(19(20(27)28)21(29)30)37-17-10-9-14(12-16(17)26(33)34)11-15(22(31)35-7-2)25-23(32)36-13-24(3,4)5/h9-10,12,15,18-19H,6-8,11,13H2,1-5H3,(H,25,32)(H,27,28)(H,29,30)/t15-,18+/m0/s1 |
| InChIKey | BSYDNRUJCFIUMY-MAUKXSAKSA-N |
| XLogP | 3.17 |
| TPSA | 191.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.54 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|