C22H31N3O6 — CID 138470732
2-methyl-2-[[(2S,3S)-3-methyl-2-[[2-oxo-4-[(2-phenylacetyl)amino]butanoyl]amino]pentanoyl]amino]propanoic acid (PubChem CID 138470732) has the molecular formula C22H31N3O6 and a molecular weight of 433.51 g/mol. Its IUPAC name is 2-methyl-2-[[(2S,3S)-3-methyl-2-[[2-oxo-4-[(2-phenylacetyl)amino]butanoyl]amino]pentanoyl]amino]propanoic acid.
| Compound Name | 2-methyl-2-[[(2S,3S)-3-methyl-2-[[2-oxo-4-[(2-phenylacetyl)amino]butanoyl]amino]pentanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 138470732 |
| Molecular Formula | C22H31N3O6 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | 2-methyl-2-[[(2S,3S)-3-methyl-2-[[2-oxo-4-[(2-phenylacetyl)amino]butanoyl]amino]pentanoyl]amino]propanoic acid |
| SMILES | CC[C@H](C)[C@H](NC(=O)C(=O)CCNC(=O)Cc1ccccc1)C(=O)NC(C)(C)C(=O)O |
| InChI | InChI=1S/C22H31N3O6/c1-5-14(2)18(20(29)25-22(3,4)21(30)31)24-19(28)16(26)11-12-23-17(27)13-15-9-7-6-8-10-15/h6-10,14,18H,5,11-13H2,1-4H3,(H,23,27)(H,24,28)(H,25,29)(H,30,31)/t14-,18-/m0/s1 |
| InChIKey | GJUSFJBCZQHLGR-KSSFIOAISA-N |
| XLogP | 0.81 |
| TPSA | 141.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|