C17H26N2O2S — CID 10403882
(2S,3S)-3-methyl-N-(2-phenylethyl)-2-(3-sulfanylpropanoylamino)pentanamide (PubChem CID 10403882) has the molecular formula C17H26N2O2S and a molecular weight of 322.47 g/mol. Its IUPAC name is (2S,3S)-3-methyl-N-(2-phenylethyl)-2-(3-sulfanylpropanoylamino)pentanamide.
| Compound Name | (2S,3S)-3-methyl-N-(2-phenylethyl)-2-(3-sulfanylpropanoylamino)pentanamide |
|---|---|
| PubChem CID | 10403882 |
| Molecular Formula | C17H26N2O2S |
| Molecular Weight | 322.47 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | (2S,3S)-3-methyl-N-(2-phenylethyl)-2-(3-sulfanylpropanoylamino)pentanamide |
| SMILES | CC[C@H](C)[C@H](NC(=O)CCS)C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C17H26N2O2S/c1-3-13(2)16(19-15(20)10-12-22)17(21)18-11-9-14-7-5-4-6-8-14/h4-8,13,16,22H,3,9-12H2,1-2H3,(H,18,21)(H,19,20)/t13-,16-/m0/s1 |
| InChIKey | HBCZABUIMRJBKA-BBRMVZONSA-N |
| XLogP | 2.20 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.47 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|