C26H36N2O2 — CID 42703936
N-(3,3-diphenylpropyl)-3-methyl-2-(3-methylbutanoylamino)pentanamide (PubChem CID 42703936) has the molecular formula C26H36N2O2 and a molecular weight of 408.59 g/mol. Its IUPAC name is N-(3,3-diphenylpropyl)-3-methyl-2-(3-methylbutanoylamino)pentanamide.
| Compound Name | N-(3,3-diphenylpropyl)-3-methyl-2-(3-methylbutanoylamino)pentanamide |
|---|---|
| PubChem CID | 42703936 |
| Molecular Formula | C26H36N2O2 |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.28 |
| IUPAC Name | N-(3,3-diphenylpropyl)-3-methyl-2-(3-methylbutanoylamino)pentanamide |
| SMILES | CCC(C)C(NC(=O)CC(C)C)C(=O)NCCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H36N2O2/c1-5-20(4)25(28-24(29)18-19(2)3)26(30)27-17-16-23(21-12-8-6-9-13-21)22-14-10-7-11-15-22/h6-15,19-20,23,25H,5,16-18H2,1-4H3,(H,27,30)(H,28,29) |
| InChIKey | ZJMCTHUHIOCMLK-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |