C28H31ClN2O2 — CID 42657080
2-[(2-chloro-2-phenylacetyl)amino]-N-(3,3-diphenylpropyl)-3-methylbutanamide (PubChem CID 42657080) has the molecular formula C28H31ClN2O2 and a molecular weight of 463.02 g/mol. Its IUPAC name is 2-[(2-chloro-2-phenylacetyl)amino]-N-(3,3-diphenylpropyl)-3-methylbutanamide.
| Compound Name | 2-[(2-chloro-2-phenylacetyl)amino]-N-(3,3-diphenylpropyl)-3-methylbutanamide |
|---|---|
| PubChem CID | 42657080 |
| Molecular Formula | C28H31ClN2O2 |
| Molecular Weight | 463.02 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | 2-[(2-chloro-2-phenylacetyl)amino]-N-(3,3-diphenylpropyl)-3-methylbutanamide |
| SMILES | CC(C)C(NC(=O)C(Cl)c1ccccc1)C(=O)NCCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H31ClN2O2/c1-20(2)26(31-27(32)25(29)23-16-10-5-11-17-23)28(33)30-19-18-24(21-12-6-3-7-13-21)22-14-8-4-9-15-22/h3-17,20,24-26H,18-19H2,1-2H3,(H,30,33)(H,31,32) |
| InChIKey | SFFGOHDZUODGBT-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.02 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|