C16H16ClNO2 — CID 107862713
2-chloro-N-[(1S)-2-hydroxy-1-phenylethyl]-2-phenylacetamide (PubChem CID 107862713) has the molecular formula C16H16ClNO2 and a molecular weight of 289.76 g/mol. Its IUPAC name is 2-chloro-N-[(1S)-2-hydroxy-1-phenylethyl]-2-phenylacetamide.
| Compound Name | 2-chloro-N-[(1S)-2-hydroxy-1-phenylethyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 107862713 |
| Molecular Formula | C16H16ClNO2 |
| Molecular Weight | 289.76 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 2-chloro-N-[(1S)-2-hydroxy-1-phenylethyl]-2-phenylacetamide |
| SMILES | O=C(N[C@H](CO)c1ccccc1)C(Cl)c1ccccc1 |
| InChI | InChI=1S/C16H16ClNO2/c17-15(13-9-5-2-6-10-13)16(20)18-14(11-19)12-7-3-1-4-8-12/h1-10,14-15,19H,11H2,(H,18,20)/t14-,15?/m1/s1 |
| InChIKey | IHFREIVWQNAABY-GICMACPYSA-N |
| XLogP | 2.82 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.76 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|