C28H25FNO5P — CID 155541554
benzyl N-[1-diphenoxyphosphoryl-2-(4-fluorophenyl)ethyl]carbamate (PubChem CID 155541554) has the molecular formula C28H25FNO5P and a molecular weight of 505.48 g/mol. Its IUPAC name is benzyl N-[1-diphenoxyphosphoryl-2-(4-fluorophenyl)ethyl]carbamate.
| Compound Name | benzyl N-[1-diphenoxyphosphoryl-2-(4-fluorophenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 155541554 |
| Molecular Formula | C28H25FNO5P |
| Molecular Weight | 505.48 g/mol |
| Exact Mass | 505.15 |
| IUPAC Name | benzyl N-[1-diphenoxyphosphoryl-2-(4-fluorophenyl)ethyl]carbamate |
| SMILES | O=C(NC(Cc1ccc(F)cc1)P(=O)(Oc1ccccc1)Oc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C28H25FNO5P/c29-24-18-16-22(17-19-24)20-27(30-28(31)33-21-23-10-4-1-5-11-23)36(32,34-25-12-6-2-7-13-25)35-26-14-8-3-9-15-26/h1-19,27H,20-21H2,(H,30,31) |
| InChIKey | NWHLPFOKUNKYQB-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.48 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|